C17H10BrCl2NO2 — CID 4567220
(5,7-dichloro-2-methylquinolin-8-yl) 3-bromobenzoate (PubChem CID 4567220) has the molecular formula C17H10BrCl2NO2 and a molecular weight of 411.08 g/mol. Its IUPAC name is (5,7-dichloro-2-methylquinolin-8-yl) 3-bromobenzoate.
| Compound Name | (5,7-dichloro-2-methylquinolin-8-yl) 3-bromobenzoate |
|---|---|
| PubChem CID | 4567220 |
| Molecular Formula | C17H10BrCl2NO2 |
| Molecular Weight | 411.08 g/mol |
| Exact Mass | 408.93 |
| IUPAC Name | (5,7-dichloro-2-methylquinolin-8-yl) 3-bromobenzoate |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OC(=O)c3cccc(Br)c3)c2n1 |
| InChI | InChI=1S/C17H10BrCl2NO2/c1-9-5-6-12-13(19)8-14(20)16(15(12)21-9)23-17(22)10-3-2-4-11(18)7-10/h2-8H,1H3 |
| InChIKey | ICSBPOIUCHPVCZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.08 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|