C21H13Cl2NO2 — CID 4530817
(5,7-dichloro-2-methylquinolin-8-yl) naphthalene-2-carboxylate (PubChem CID 4530817) has the molecular formula C21H13Cl2NO2 and a molecular weight of 382.25 g/mol. Its IUPAC name is (5,7-dichloro-2-methylquinolin-8-yl) naphthalene-2-carboxylate.
| Compound Name | (5,7-dichloro-2-methylquinolin-8-yl) naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 4530817 |
| Molecular Formula | C21H13Cl2NO2 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (5,7-dichloro-2-methylquinolin-8-yl) naphthalene-2-carboxylate |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OC(=O)c3ccc4ccccc4c3)c2n1 |
| InChI | InChI=1S/C21H13Cl2NO2/c1-12-6-9-16-17(22)11-18(23)20(19(16)24-12)26-21(25)15-8-7-13-4-2-3-5-14(13)10-15/h2-11H,1H3 |
| InChIKey | YGXOZWSIAUXESJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|