C18H12BrCl2NO2 — CID 5021915
(5,7-dichloro-2-methylquinolin-8-yl) 2-(4-bromophenyl)acetate (PubChem CID 5021915) has the molecular formula C18H12BrCl2NO2 and a molecular weight of 425.11 g/mol. Its IUPAC name is (5,7-dichloro-2-methylquinolin-8-yl) 2-(4-bromophenyl)acetate.
| Compound Name | (5,7-dichloro-2-methylquinolin-8-yl) 2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 5021915 |
| Molecular Formula | C18H12BrCl2NO2 |
| Molecular Weight | 425.11 g/mol |
| Exact Mass | 422.94 |
| IUPAC Name | (5,7-dichloro-2-methylquinolin-8-yl) 2-(4-bromophenyl)acetate |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OC(=O)Cc3ccc(Br)cc3)c2n1 |
| InChI | InChI=1S/C18H12BrCl2NO2/c1-10-2-7-13-14(20)9-15(21)18(17(13)22-10)24-16(23)8-11-3-5-12(19)6-4-11/h2-7,9H,8H2,1H3 |
| InChIKey | BFUIAZWTOWNSJE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.11 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|