C17H9Cl3N2O4 — CID 5129890
(5,7-dichloro-2-methylquinolin-8-yl) 4-chloro-3-nitrobenzoate (PubChem CID 5129890) has the molecular formula C17H9Cl3N2O4 and a molecular weight of 411.63 g/mol. Its IUPAC name is (5,7-dichloro-2-methylquinolin-8-yl) 4-chloro-3-nitrobenzoate.
| Compound Name | (5,7-dichloro-2-methylquinolin-8-yl) 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 5129890 |
| Molecular Formula | C17H9Cl3N2O4 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | (5,7-dichloro-2-methylquinolin-8-yl) 4-chloro-3-nitrobenzoate |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2n1 |
| InChI | InChI=1S/C17H9Cl3N2O4/c1-8-2-4-10-12(19)7-13(20)16(15(10)21-8)26-17(23)9-3-5-11(18)14(6-9)22(24)25/h2-7H,1H3 |
| InChIKey | PKZYUHOJLRZLPZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|