C15H11BrClNO4 — CID 3307499
(4-bromo-2,6-dimethylphenyl) 4-chloro-3-nitrobenzoate (PubChem CID 3307499) has the molecular formula C15H11BrClNO4 and a molecular weight of 384.61 g/mol. Its IUPAC name is (4-bromo-2,6-dimethylphenyl) 4-chloro-3-nitrobenzoate.
| Compound Name | (4-bromo-2,6-dimethylphenyl) 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 3307499 |
| Molecular Formula | C15H11BrClNO4 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | (4-bromo-2,6-dimethylphenyl) 4-chloro-3-nitrobenzoate |
| SMILES | Cc1cc(Br)cc(C)c1OC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11BrClNO4/c1-8-5-11(16)6-9(2)14(8)22-15(19)10-3-4-12(17)13(7-10)18(20)21/h3-7H,1-2H3 |
| InChIKey | KZQYIXATTMTLDA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|