C11H8ClN3O5 — CID 31047836
(3-methyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate (PubChem CID 31047836) has the molecular formula C11H8ClN3O5 and a molecular weight of 297.65 g/mol. Its IUPAC name is (3-methyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate.
| Compound Name | (3-methyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 31047836 |
| Molecular Formula | C11H8ClN3O5 |
| Molecular Weight | 297.65 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | (3-methyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate |
| SMILES | Cc1noc(COC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H8ClN3O5/c1-6-13-10(20-14-6)5-19-11(16)7-2-3-8(12)9(4-7)15(17)18/h2-4H,5H2,1H3 |
| InChIKey | HCNCEKWAACYMON-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.65 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|