C22H16Cl2N2O2 — CID 7997855
2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N-naphthalen-2-ylacetamide (PubChem CID 7997855) has the molecular formula C22H16Cl2N2O2 and a molecular weight of 411.29 g/mol. Its IUPAC name is 2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N-naphthalen-2-ylacetamide.
| Compound Name | 2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 7997855 |
| Molecular Formula | C22H16Cl2N2O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N-naphthalen-2-ylacetamide |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OCC(=O)Nc3ccc4ccccc4c3)c2n1 |
| InChI | InChI=1S/C22H16Cl2N2O2/c1-13-6-9-17-18(23)11-19(24)22(21(17)25-13)28-12-20(27)26-16-8-7-14-4-2-3-5-15(14)10-16/h2-11H,12H2,1H3,(H,26,27) |
| InChIKey | ISKWKAAGCUSCJH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |