C24H18Cl2N2O3 — CID 23908018
2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N-(2-phenoxyphenyl)acetamide (PubChem CID 23908018) has the molecular formula C24H18Cl2N2O3 and a molecular weight of 453.33 g/mol. Its IUPAC name is 2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N-(2-phenoxyphenyl)acetamide.
| Compound Name | 2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N-(2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23908018 |
| Molecular Formula | C24H18Cl2N2O3 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N-(2-phenoxyphenyl)acetamide |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OCC(=O)Nc3ccccc3Oc3ccccc3)c2n1 |
| InChI | InChI=1S/C24H18Cl2N2O3/c1-15-11-12-17-18(25)13-19(26)24(23(17)27-15)30-14-22(29)28-20-9-5-6-10-21(20)31-16-7-3-2-4-8-16/h2-13H,14H2,1H3,(H,28,29) |
| InChIKey | WFSIBGXDCSMVKC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |