C18H19Cl2N3O4S — CID 26654573
3-[[(3,4-dichlorobenzoyl)amino]carbamoyl]-N,N-diethylbenzenesulfonamide (PubChem CID 26654573) has the molecular formula C18H19Cl2N3O4S and a molecular weight of 444.34 g/mol. Its IUPAC name is 3-[[(3,4-dichlorobenzoyl)amino]carbamoyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[[(3,4-dichlorobenzoyl)amino]carbamoyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 26654573 |
| Molecular Formula | C18H19Cl2N3O4S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 3-[[(3,4-dichlorobenzoyl)amino]carbamoyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NNC(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H19Cl2N3O4S/c1-3-23(4-2)28(26,27)14-7-5-6-12(10-14)17(24)21-22-18(25)13-8-9-15(19)16(20)11-13/h5-11H,3-4H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | BEHHXUHIHXUWFY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|