C25H27N3O5S — CID 26654618
N,N-diethyl-3-[[(3-phenylmethoxybenzoyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 26654618) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is N,N-diethyl-3-[[(3-phenylmethoxybenzoyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[[(3-phenylmethoxybenzoyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26654618 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N,N-diethyl-3-[[(3-phenylmethoxybenzoyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NNC(=O)c2cccc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H27N3O5S/c1-3-28(4-2)34(31,32)23-15-9-13-21(17-23)25(30)27-26-24(29)20-12-8-14-22(16-20)33-18-19-10-6-5-7-11-19/h5-17H,3-4,18H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | DKBBKKBBTJGDAR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|