C20H24ClN3O4S2 — CID 26654520
3-[[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide (PubChem CID 26654520) has the molecular formula C20H24ClN3O4S2 and a molecular weight of 470.02 g/mol. Its IUPAC name is 3-[[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 26654520 |
| Molecular Formula | C20H24ClN3O4S2 |
| Molecular Weight | 470.02 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 3-[[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NNC(=O)CSCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C20H24ClN3O4S2/c1-3-24(4-2)30(27,28)18-10-6-8-16(12-18)20(26)23-22-19(25)14-29-13-15-7-5-9-17(21)11-15/h5-12H,3-4,13-14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | UYMOGIHFBRYASO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.02 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|