C11H15ClN2OS — CID 9179466
2-[(3-chlorophenyl)methylsulfanyl]-N',N'-dimethylacetohydrazide (PubChem CID 9179466) has the molecular formula C11H15ClN2OS and a molecular weight of 258.77 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylsulfanyl]-N',N'-dimethylacetohydrazide.
| Compound Name | 2-[(3-chlorophenyl)methylsulfanyl]-N',N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 9179466 |
| Molecular Formula | C11H15ClN2OS |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-[(3-chlorophenyl)methylsulfanyl]-N',N'-dimethylacetohydrazide |
| SMILES | CN(C)NC(=O)CSCc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2OS/c1-14(2)13-11(15)8-16-7-9-4-3-5-10(12)6-9/h3-6H,7-8H2,1-2H3,(H,13,15) |
| InChIKey | NMZBPWVKNGKOJE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|