C15H20ClNO3S — CID 43238428
6-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]hexanoic acid (PubChem CID 43238428) has the molecular formula C15H20ClNO3S and a molecular weight of 329.85 g/mol. Its IUPAC name is 6-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 43238428 |
| Molecular Formula | C15H20ClNO3S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 6-[[2-[(3-chlorophenyl)methylsulfanyl]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CSCc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20ClNO3S/c16-13-6-4-5-12(9-13)10-21-11-14(18)17-8-3-1-2-7-15(19)20/h4-6,9H,1-3,7-8,10-11H2,(H,17,18)(H,19,20) |
| InChIKey | XDHKVCCLCGJPAK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|