C15H19Cl2NO3S — CID 119219944
6-[[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]hexanoic acid (PubChem CID 119219944) has the molecular formula C15H19Cl2NO3S and a molecular weight of 364.29 g/mol. Its IUPAC name is 6-[[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119219944 |
| Molecular Formula | C15H19Cl2NO3S |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 6-[[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2NO3S/c16-12-6-5-11(13(17)8-12)9-22-10-14(19)18-7-3-1-2-4-15(20)21/h5-6,8H,1-4,7,9-10H2,(H,18,19)(H,20,21) |
| InChIKey | XIRHFECBAGGZCL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|