C13H18Cl2N2OS — CID 119431045
2-[(2,4-dichlorophenyl)methylsulfanyl]-N-[3-(methylamino)propyl]acetamide (PubChem CID 119431045) has the molecular formula C13H18Cl2N2OS and a molecular weight of 321.27 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylsulfanyl]-N-[3-(methylamino)propyl]acetamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methylsulfanyl]-N-[3-(methylamino)propyl]acetamide |
|---|---|
| PubChem CID | 119431045 |
| Molecular Formula | C13H18Cl2N2OS |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylsulfanyl]-N-[3-(methylamino)propyl]acetamide |
| SMILES | CNCCCNC(=O)CSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N2OS/c1-16-5-2-6-17-13(18)9-19-8-10-3-4-11(14)7-12(10)15/h3-4,7,16H,2,5-6,8-9H2,1H3,(H,17,18) |
| InChIKey | XZTXAYFYZABEBI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|