C17H16Cl3NO2S — CID 2290637
2-(4-chlorophenoxy)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 2290637) has the molecular formula C17H16Cl3NO2S and a molecular weight of 404.75 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 2290637 |
| Molecular Formula | C17H16Cl3NO2S |
| Molecular Weight | 404.75 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NCCSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl3NO2S/c18-13-3-5-15(6-4-13)23-10-17(22)21-7-8-24-11-12-1-2-14(19)9-16(12)20/h1-6,9H,7-8,10-11H2,(H,21,22) |
| InChIKey | ALEQWEFUOARFAB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|