C18H19Cl2NOS — CID 100605659
N-(2-benzylsulfanylethyl)-3-(2,4-dichlorophenyl)propanamide (PubChem CID 100605659) has the molecular formula C18H19Cl2NOS and a molecular weight of 368.33 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-3-(2,4-dichlorophenyl)propanamide.
| Compound Name | N-(2-benzylsulfanylethyl)-3-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 100605659 |
| Molecular Formula | C18H19Cl2NOS |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-3-(2,4-dichlorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)NCCSCc1ccccc1 |
| InChI | InChI=1S/C18H19Cl2NOS/c19-16-8-6-15(17(20)12-16)7-9-18(22)21-10-11-23-13-14-4-2-1-3-5-14/h1-6,8,12H,7,9-11,13H2,(H,21,22) |
| InChIKey | QHLLKIVCWKUFOB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|