C17H17BrClNO2S — CID 7488647
N-(2-benzylsulfanylethyl)-2-(2-bromo-4-chlorophenoxy)acetamide (PubChem CID 7488647) has the molecular formula C17H17BrClNO2S and a molecular weight of 414.75 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-2-(2-bromo-4-chlorophenoxy)acetamide.
| Compound Name | N-(2-benzylsulfanylethyl)-2-(2-bromo-4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7488647 |
| Molecular Formula | C17H17BrClNO2S |
| Molecular Weight | 414.75 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-2-(2-bromo-4-chlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Br)NCCSCc1ccccc1 |
| InChI | InChI=1S/C17H17BrClNO2S/c18-15-10-14(19)6-7-16(15)22-11-17(21)20-8-9-23-12-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2,(H,20,21) |
| InChIKey | XQJRIVXDDOAPRG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.75 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|