C15H15Cl2NO2S2 — CID 7582593
2-(2,4-dichlorophenoxy)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 7582593) has the molecular formula C15H15Cl2NO2S2 and a molecular weight of 376.33 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 7582593 |
| Molecular Formula | C15H15Cl2NO2S2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCSCc1cccs1 |
| InChI | InChI=1S/C15H15Cl2NO2S2/c16-11-3-4-14(13(17)8-11)20-9-15(19)18-5-7-21-10-12-2-1-6-22-12/h1-4,6,8H,5,7,9-10H2,(H,18,19) |
| InChIKey | JDIGJELKMREFKB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|