C15H15ClFNO2S2 — CID 18226871
2-(2-chloro-4-fluorophenoxy)-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 18226871) has the molecular formula C15H15ClFNO2S2 and a molecular weight of 359.88 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 18226871 |
| Molecular Formula | C15H15ClFNO2S2 |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | O=C(COc1ccc(F)cc1Cl)NCCSCc1ccsc1 |
| InChI | InChI=1S/C15H15ClFNO2S2/c16-13-7-12(17)1-2-14(13)20-8-15(19)18-4-6-22-10-11-3-5-21-9-11/h1-3,5,7,9H,4,6,8,10H2,(H,18,19) |
| InChIKey | XBHWMRQFNHYDTL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|