C18H21NO3S2 — CID 18119889
2-(5-acetyl-2-methoxyphenyl)-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 18119889) has the molecular formula C18H21NO3S2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-(5-acetyl-2-methoxyphenyl)-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(5-acetyl-2-methoxyphenyl)-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 18119889 |
| Molecular Formula | C18H21NO3S2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-(5-acetyl-2-methoxyphenyl)-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)NCCSCc1ccsc1 |
| InChI | InChI=1S/C18H21NO3S2/c1-13(20)15-3-4-17(22-2)16(9-15)10-18(21)19-6-8-24-12-14-5-7-23-11-14/h3-5,7,9,11H,6,8,10,12H2,1-2H3,(H,19,21) |
| InChIKey | UVDNIQRBJHXZLM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|