C16H16ClNO3S2 — CID 8860321
[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 2-chlorobenzoate (PubChem CID 8860321) has the molecular formula C16H16ClNO3S2 and a molecular weight of 369.90 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 2-chlorobenzoate.
| Compound Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 8860321 |
| Molecular Formula | C16H16ClNO3S2 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 2-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Cl)NCCSCc1cccs1 |
| InChI | InChI=1S/C16H16ClNO3S2/c17-14-6-2-1-5-13(14)16(20)21-10-15(19)18-7-9-22-11-12-4-3-8-23-12/h1-6,8H,7,9-11H2,(H,18,19) |
| InChIKey | SCPXTKXXBBUZFI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|