C12H17Cl3N2O — CID 119408221
N-(3-aminopropyl)-3-(2,4-dichlorophenyl)propanamide;hydrochloride (PubChem CID 119408221) has the molecular formula C12H17Cl3N2O and a molecular weight of 311.64 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(2,4-dichlorophenyl)propanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3-(2,4-dichlorophenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119408221 |
| Molecular Formula | C12H17Cl3N2O |
| Molecular Weight | 311.64 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N-(3-aminopropyl)-3-(2,4-dichlorophenyl)propanamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2O.ClH/c13-10-4-2-9(11(14)8-10)3-5-12(17)16-7-1-6-15;/h2,4,8H,1,3,5-7,15H2,(H,16,17);1H |
| InChIKey | ZHDZPHFWIKPMCE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|