C18H18Cl3NO — CID 100608161
N-[3-(2-chlorophenyl)propyl]-3-(2,4-dichlorophenyl)propanamide (PubChem CID 100608161) has the molecular formula C18H18Cl3NO and a molecular weight of 370.71 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)propyl]-3-(2,4-dichlorophenyl)propanamide.
| Compound Name | N-[3-(2-chlorophenyl)propyl]-3-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 100608161 |
| Molecular Formula | C18H18Cl3NO |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-[3-(2-chlorophenyl)propyl]-3-(2,4-dichlorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)NCCCc1ccccc1Cl |
| InChI | InChI=1S/C18H18Cl3NO/c19-15-9-7-14(17(21)12-15)8-10-18(23)22-11-3-5-13-4-1-2-6-16(13)20/h1-2,4,6-7,9,12H,3,5,8,10-11H2,(H,22,23) |
| InChIKey | XOFXLMKNTSANCO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|