C14H16ClF3N2O2 — CID 108934902
3-(2-chlorophenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]propanamide (PubChem CID 108934902) has the molecular formula C14H16ClF3N2O2 and a molecular weight of 336.74 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]propanamide.
| Compound Name | 3-(2-chlorophenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 108934902 |
| Molecular Formula | C14H16ClF3N2O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]propanamide |
| SMILES | O=C(CCc1ccccc1Cl)NCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H16ClF3N2O2/c15-11-5-2-1-4-10(11)6-7-12(21)19-8-3-9-20-13(22)14(16,17)18/h1-2,4-5H,3,6-9H2,(H,19,21)(H,20,22) |
| InChIKey | KXNQWXUMDQMYMH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|