C15H22ClNO2 — CID 110610239
4-(2-chlorophenyl)-N-(4-methoxybutyl)butanamide (PubChem CID 110610239) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-(4-methoxybutyl)butanamide.
| Compound Name | 4-(2-chlorophenyl)-N-(4-methoxybutyl)butanamide |
|---|---|
| PubChem CID | 110610239 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 4-(2-chlorophenyl)-N-(4-methoxybutyl)butanamide |
| SMILES | COCCCCNC(=O)CCCc1ccccc1Cl |
| InChI | InChI=1S/C15H22ClNO2/c1-19-12-5-4-11-17-15(18)10-6-8-13-7-2-3-9-14(13)16/h2-3,7,9H,4-6,8,10-12H2,1H3,(H,17,18) |
| InChIKey | YNKZLSCKZTVLQZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|