C14H22N2O2 — CID 110610244
N-(4-methoxybutyl)-4-pyridin-3-ylbutanamide (PubChem CID 110610244) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is N-(4-methoxybutyl)-4-pyridin-3-ylbutanamide.
| Compound Name | N-(4-methoxybutyl)-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110610244 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N-(4-methoxybutyl)-4-pyridin-3-ylbutanamide |
| SMILES | COCCCCNC(=O)CCCc1cccnc1 |
| InChI | InChI=1S/C14H22N2O2/c1-18-11-3-2-10-16-14(17)8-4-6-13-7-5-9-15-12-13/h5,7,9,12H,2-4,6,8,10-11H2,1H3,(H,16,17) |
| InChIKey | FHRXIKDSAIAFBH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|