C14H23N3O — CID 110408294
N-[3-(dimethylamino)propyl]-4-pyridin-3-ylbutanamide (PubChem CID 110408294) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-pyridin-3-ylbutanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110408294 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-pyridin-3-ylbutanamide |
| SMILES | CN(C)CCCNC(=O)CCCc1cccnc1 |
| InChI | InChI=1S/C14H23N3O/c1-17(2)11-5-10-16-14(18)8-3-6-13-7-4-9-15-12-13/h4,7,9,12H,3,5-6,8,10-11H2,1-2H3,(H,16,18) |
| InChIKey | RQMYDJMWOVCJSX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|