C21H29N3O — CID 110623832
N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-4-pyridin-3-ylbutanamide (PubChem CID 110623832) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-4-pyridin-3-ylbutanamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110623832 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-4-pyridin-3-ylbutanamide |
| SMILES | CCc1ccc(C(CNC(=O)CCCc2cccnc2)N(C)C)cc1 |
| InChI | InChI=1S/C21H29N3O/c1-4-17-10-12-19(13-11-17)20(24(2)3)16-23-21(25)9-5-7-18-8-6-14-22-15-18/h6,8,10-15,20H,4-5,7,9,16H2,1-3H3,(H,23,25) |
| InChIKey | OHPLXNGOTRGCLI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |