C19H24N2O — CID 91761122
3-(3,4-dimethylphenyl)-N-(3-pyridin-3-ylpropyl)propanamide (PubChem CID 91761122) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-(3-pyridin-3-ylpropyl)propanamide.
| Compound Name | 3-(3,4-dimethylphenyl)-N-(3-pyridin-3-ylpropyl)propanamide |
|---|---|
| PubChem CID | 91761122 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-(3-pyridin-3-ylpropyl)propanamide |
| SMILES | Cc1ccc(CCC(=O)NCCCc2cccnc2)cc1C |
| InChI | InChI=1S/C19H24N2O/c1-15-7-8-17(13-16(15)2)9-10-19(22)21-12-4-6-18-5-3-11-20-14-18/h3,5,7-8,11,13-14H,4,6,9-10,12H2,1-2H3,(H,21,22) |
| InChIKey | SEMBTYXBWSFXMU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|