C13H19ClNO3PS2 — CID 88595925
4-(2-chlorophenyl)-N-(dimethoxyphosphinothioylsulfanylmethyl)butanamide (PubChem CID 88595925) has the molecular formula C13H19ClNO3PS2 and a molecular weight of 367.86 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-(dimethoxyphosphinothioylsulfanylmethyl)butanamide.
| Compound Name | 4-(2-chlorophenyl)-N-(dimethoxyphosphinothioylsulfanylmethyl)butanamide |
|---|---|
| PubChem CID | 88595925 |
| Molecular Formula | C13H19ClNO3PS2 |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-(2-chlorophenyl)-N-(dimethoxyphosphinothioylsulfanylmethyl)butanamide |
| SMILES | COP(=S)(OC)SCNC(=O)CCCc1ccccc1Cl |
| InChI | InChI=1S/C13H19ClNO3PS2/c1-17-19(20,18-2)21-10-15-13(16)9-5-7-11-6-3-4-8-12(11)14/h3-4,6,8H,5,7,9-10H2,1-2H3,(H,15,16) |
| InChIKey | ODNQFKDTECLALE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|