C16H22ClNO3 — CID 43404503
methyl 6-[3-(2-chlorophenyl)propanoylamino]hexanoate (PubChem CID 43404503) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is methyl 6-[3-(2-chlorophenyl)propanoylamino]hexanoate.
| Compound Name | methyl 6-[3-(2-chlorophenyl)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 43404503 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | methyl 6-[3-(2-chlorophenyl)propanoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C16H22ClNO3/c1-21-16(20)9-3-2-6-12-18-15(19)11-10-13-7-4-5-8-14(13)17/h4-5,7-8H,2-3,6,9-12H2,1H3,(H,18,19) |
| InChIKey | WVESTISVRYPPHT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|