C15H19Cl2NOS — CID 100621291
N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide (PubChem CID 100621291) has the molecular formula C15H19Cl2NOS and a molecular weight of 332.30 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 100621291 |
| Molecular Formula | C15H19Cl2NOS |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide |
| SMILES | O=C(NCCSCc1ccc(Cl)cc1Cl)C1CCCC1 |
| InChI | InChI=1S/C15H19Cl2NOS/c16-13-6-5-12(14(17)9-13)10-20-8-7-18-15(19)11-3-1-2-4-11/h5-6,9,11H,1-4,7-8,10H2,(H,18,19) |
| InChIKey | YKNGIAXWBKMWAM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|