C19H26Cl2N2O2 — CID 109144341
4-N-[2-(2,4-dichlorophenyl)ethyl]-1-N-propylcyclohexane-1,4-dicarboxamide (PubChem CID 109144341) has the molecular formula C19H26Cl2N2O2 and a molecular weight of 385.34 g/mol. Its IUPAC name is 4-N-[2-(2,4-dichlorophenyl)ethyl]-1-N-propylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-[2-(2,4-dichlorophenyl)ethyl]-1-N-propylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109144341 |
| Molecular Formula | C19H26Cl2N2O2 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-N-[2-(2,4-dichlorophenyl)ethyl]-1-N-propylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCNC(=O)C1CCC(C(=O)NCCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H26Cl2N2O2/c1-2-10-22-18(24)14-3-5-15(6-4-14)19(25)23-11-9-13-7-8-16(20)12-17(13)21/h7-8,12,14-15H,2-6,9-11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | XQGUQAHLICQKQY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |