C17H22Cl2N2O2 — CID 109144433
4-N-(2,4-dichlorophenyl)-1-N-propylcyclohexane-1,4-dicarboxamide (PubChem CID 109144433) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is 4-N-(2,4-dichlorophenyl)-1-N-propylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(2,4-dichlorophenyl)-1-N-propylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109144433 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 4-N-(2,4-dichlorophenyl)-1-N-propylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCNC(=O)C1CCC(C(=O)Nc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-2-9-20-16(22)11-3-5-12(6-4-11)17(23)21-15-8-7-13(18)10-14(15)19/h7-8,10-12H,2-6,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | AQYFQFMPSXTWFT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |