C14H16Cl2N2O2 — CID 109130599
1-N-(2,5-dichlorophenyl)-2-N-propylcyclopropane-1,2-dicarboxamide (PubChem CID 109130599) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 1-N-(2,5-dichlorophenyl)-2-N-propylcyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(2,5-dichlorophenyl)-2-N-propylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109130599 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-N-(2,5-dichlorophenyl)-2-N-propylcyclopropane-1,2-dicarboxamide |
| SMILES | CCCNC(=O)C1CC1C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H16Cl2N2O2/c1-2-5-17-13(19)9-7-10(9)14(20)18-12-6-8(15)3-4-11(12)16/h3-4,6,9-10H,2,5,7H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | PLCCJICBMZNCIM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |