C20H28Cl2N2O2 — CID 109149558
4-N-tert-butyl-1-N-[2-(2,4-dichlorophenyl)ethyl]cyclohexane-1,4-dicarboxamide (PubChem CID 109149558) has the molecular formula C20H28Cl2N2O2 and a molecular weight of 399.36 g/mol. Its IUPAC name is 4-N-tert-butyl-1-N-[2-(2,4-dichlorophenyl)ethyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-tert-butyl-1-N-[2-(2,4-dichlorophenyl)ethyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149558 |
| Molecular Formula | C20H28Cl2N2O2 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-N-tert-butyl-1-N-[2-(2,4-dichlorophenyl)ethyl]cyclohexane-1,4-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)C1CCC(C(=O)NCCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C20H28Cl2N2O2/c1-20(2,3)24-19(26)15-6-4-14(5-7-15)18(25)23-11-10-13-8-9-16(21)12-17(13)22/h8-9,12,14-15H,4-7,10-11H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | ZZHSYOBUJPKIJN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |