C14H18Cl2N2O — CID 102777056
N-[2-(2,4-dichlorophenyl)ethyl]-3-methylpyrrolidine-2-carboxamide (PubChem CID 102777056) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-3-methylpyrrolidine-2-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 102777056 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-methylpyrrolidine-2-carboxamide |
| SMILES | CC1CCNC1C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O/c1-9-4-6-17-13(9)14(19)18-7-5-10-2-3-11(15)8-12(10)16/h2-3,8-9,13,17H,4-7H2,1H3,(H,18,19) |
| InChIKey | CAELCZBMDXKOOZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |