C15H20Cl2N2O — CID 107067147
N-[2-(2,4-dichlorophenyl)ethyl]-3-methylpiperidine-2-carboxamide (PubChem CID 107067147) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-3-methylpiperidine-2-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 107067147 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-methylpiperidine-2-carboxamide |
| SMILES | CC1CCCNC1C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O/c1-10-3-2-7-18-14(10)15(20)19-8-6-11-4-5-12(16)9-13(11)17/h4-5,9-10,14,18H,2-3,6-8H2,1H3,(H,19,20) |
| InChIKey | TTZZFXVGZZBQQB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |