C16H22Cl2N2O — CID 93492122
(3S)-1-[(2,4-dichlorophenyl)methyl]-N-propylpiperidine-3-carboxamide (PubChem CID 93492122) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is (3S)-1-[(2,4-dichlorophenyl)methyl]-N-propylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2,4-dichlorophenyl)methyl]-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 93492122 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (3S)-1-[(2,4-dichlorophenyl)methyl]-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)[C@H]1CCCN(Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C16H22Cl2N2O/c1-2-7-19-16(21)13-4-3-8-20(11-13)10-12-5-6-14(17)9-15(12)18/h5-6,9,13H,2-4,7-8,10-11H2,1H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | SPRZNANNYXTDBM-ZDUSSCGKSA-N |
| XLogP | 3.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |