C17H24Cl2N2O — CID 43924214
N-butyl-1-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43924214) has the molecular formula C17H24Cl2N2O and a molecular weight of 343.30 g/mol. Its IUPAC name is N-butyl-1-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-butyl-1-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43924214 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-butyl-1-[(2,4-dichlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C17H24Cl2N2O/c1-2-3-8-20-17(22)14-5-4-9-21(12-14)11-13-6-7-15(18)10-16(13)19/h6-7,10,14H,2-5,8-9,11-12H2,1H3,(H,20,22) |
| InChIKey | RGMLONITCGIAIN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|