C15H18Cl2N2O3S — CID 122009024
1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethylcarbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 122009024) has the molecular formula C15H18Cl2N2O3S and a molecular weight of 377.29 g/mol. Its IUPAC name is 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethylcarbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethylcarbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122009024 |
| Molecular Formula | C15H18Cl2N2O3S |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethylcarbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)NCCSCc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C15H18Cl2N2O3S/c16-12-2-1-11(13(17)7-12)9-23-6-4-18-15(22)19-5-3-10(8-19)14(20)21/h1-2,7,10H,3-6,8-9H2,(H,18,22)(H,20,21) |
| InChIKey | LPPVJJYTZQRZBS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|