C15H20Cl2N2OS — CID 91647284
N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide (PubChem CID 91647284) has the molecular formula C15H20Cl2N2OS and a molecular weight of 347.31 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91647284 |
| Molecular Formula | C15H20Cl2N2OS |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCSCc1ccc(Cl)cc1Cl)C1CCNCC1 |
| InChI | InChI=1S/C15H20Cl2N2OS/c16-13-2-1-12(14(17)9-13)10-21-8-7-19-15(20)11-3-5-18-6-4-11/h1-2,9,11,18H,3-8,10H2,(H,19,20) |
| InChIKey | JYIWJWZLUPUEPW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|