C16H22Cl2N2OS — CID 100744347
1-cyclohexyl-3-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]urea (PubChem CID 100744347) has the molecular formula C16H22Cl2N2OS and a molecular weight of 361.34 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]urea |
|---|---|
| PubChem CID | 100744347 |
| Molecular Formula | C16H22Cl2N2OS |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 1-cyclohexyl-3-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]urea |
| SMILES | O=C(NCCSCc1ccc(Cl)cc1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C16H22Cl2N2OS/c17-13-7-6-12(15(18)10-13)11-22-9-8-19-16(21)20-14-4-2-1-3-5-14/h6-7,10,14H,1-5,8-9,11H2,(H2,19,20,21) |
| InChIKey | FDYCTPOZFSTMRG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|