C16H23ClN2OS — CID 100744275
1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-cyclohexylurea (PubChem CID 100744275) has the molecular formula C16H23ClN2OS and a molecular weight of 326.89 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-cyclohexylurea.
| Compound Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 100744275 |
| Molecular Formula | C16H23ClN2OS |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-cyclohexylurea |
| SMILES | O=C(NCCSCc1ccccc1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C16H23ClN2OS/c17-15-9-5-4-6-13(15)12-21-11-10-18-16(20)19-14-7-2-1-3-8-14/h4-6,9,14H,1-3,7-8,10-12H2,(H2,18,19,20) |
| InChIKey | KZZUQPCQUOTAQI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|