C14H17Cl2N3O2 — CID 112995921
2-(cyclopropylcarbamoylamino)-N-[2-(2,4-dichlorophenyl)ethyl]acetamide (PubChem CID 112995921) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is 2-(cyclopropylcarbamoylamino)-N-[2-(2,4-dichlorophenyl)ethyl]acetamide.
| Compound Name | 2-(cyclopropylcarbamoylamino)-N-[2-(2,4-dichlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 112995921 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-(cyclopropylcarbamoylamino)-N-[2-(2,4-dichlorophenyl)ethyl]acetamide |
| SMILES | O=C(CNC(=O)NC1CC1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2N3O2/c15-10-2-1-9(12(16)7-10)5-6-17-13(20)8-18-14(21)19-11-3-4-11/h1-2,7,11H,3-6,8H2,(H,17,20)(H2,18,19,21) |
| InChIKey | FAXVEJSCDFOTEL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |