C16H20Cl2N2O3 — CID 122004839
1-[3-(2,4-dichlorophenyl)propylcarbamoyl]piperidine-3-carboxylic acid (PubChem CID 122004839) has the molecular formula C16H20Cl2N2O3 and a molecular weight of 359.25 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenyl)propylcarbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[3-(2,4-dichlorophenyl)propylcarbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122004839 |
| Molecular Formula | C16H20Cl2N2O3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-[3-(2,4-dichlorophenyl)propylcarbamoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)NCCCc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C16H20Cl2N2O3/c17-13-6-5-11(14(18)9-13)3-1-7-19-16(23)20-8-2-4-12(10-20)15(21)22/h5-6,9,12H,1-4,7-8,10H2,(H,19,23)(H,21,22) |
| InChIKey | UHDOBCLGUIINNV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|