C9H15ClN2O3 — CID 16769399
1-(2-chloroethylcarbamoyl)piperidine-3-carboxylic acid (PubChem CID 16769399) has the molecular formula C9H15ClN2O3 and a molecular weight of 234.68 g/mol. Its IUPAC name is 1-(2-chloroethylcarbamoyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(2-chloroethylcarbamoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 16769399 |
| Molecular Formula | C9H15ClN2O3 |
| Molecular Weight | 234.68 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1-(2-chloroethylcarbamoyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)NCCCl)C1 |
| InChI | InChI=1S/C9H15ClN2O3/c10-3-4-11-9(15)12-5-1-2-7(6-12)8(13)14/h7H,1-6H2,(H,11,15)(H,13,14) |
| InChIKey | OMDJYLAAILDAIJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.68 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|