C10H18N4O4 — CID 83114124
(3R)-1-[2-(carbamoylamino)ethylcarbamoyl]piperidine-3-carboxylic acid (PubChem CID 83114124) has the molecular formula C10H18N4O4 and a molecular weight of 258.28 g/mol. Its IUPAC name is (3R)-1-[2-(carbamoylamino)ethylcarbamoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-(carbamoylamino)ethylcarbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 83114124 |
| Molecular Formula | C10H18N4O4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (3R)-1-[2-(carbamoylamino)ethylcarbamoyl]piperidine-3-carboxylic acid |
| SMILES | NC(=O)NCCNC(=O)N1CCC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C10H18N4O4/c11-9(17)12-3-4-13-10(18)14-5-1-2-7(6-14)8(15)16/h7H,1-6H2,(H,13,18)(H,15,16)(H3,11,12,17)/t7-/m1/s1 |
| InChIKey | GUTTZKIQHZGOFK-SSDOTTSWSA-N |
| XLogP | -0.84 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|