C11H16N2O3 — CID 81120069
(3R)-1-(but-3-ynylcarbamoyl)piperidine-3-carboxylic acid (PubChem CID 81120069) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3R)-1-(but-3-ynylcarbamoyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(but-3-ynylcarbamoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81120069 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (3R)-1-(but-3-ynylcarbamoyl)piperidine-3-carboxylic acid |
| SMILES | C#CCCNC(=O)N1CCC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C11H16N2O3/c1-2-3-6-12-11(16)13-7-4-5-9(8-13)10(14)15/h1,9H,3-8H2,(H,12,16)(H,14,15)/t9-/m1/s1 |
| InChIKey | HSNRPJXJDNFLHM-SECBINFHSA-N |
| XLogP | 0.52 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|